CAS 1363382-23-3

5-Iodo-1-methyl-1H-indazole-3-carboxylic acid

Description:

5-Iodo-1-methyl-1H-indazole-3-carboxylic acid is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of an iodine atom at the 5-position and a carboxylic acid functional group at the 3-position contributes to its unique reactivity and potential applications in medicinal chemistry. The methyl group at the 1-position enhances its lipophilicity, which can influence its biological activity and solubility. This compound may exhibit interesting pharmacological properties, making it a subject of interest in drug discovery and development. Its molecular structure allows for various interactions with biological targets, potentially leading to therapeutic effects. Additionally, the presence of the iodine atom can facilitate certain types of chemical reactions, such as nucleophilic substitutions or coupling reactions, which are valuable in synthetic organic chemistry. Overall, 5-Iodo-1-methyl-1H-indazole-3-carboxylic acid represents a versatile scaffold for further chemical modifications and investigations in various fields of research.

Formula: C₉H₇IN₂O₂

InChI: InChI=1S/C9H7IN2O2/c1-12-7-3-2-5(10)4-6(7)8(11-12)9(13)14/h2-4H,1H3,(H,13,14)

InChI key: InChIKey=XOECXFXLPGIMCQ-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C=2C(N(C)N1)=CC=C(I)C2

Synonyms:

• 5-Iodo-1-methyl-1H-indazole-3-carboxylic acid
• 1H-Indazole-3-carboxylic acid, 5-iodo-1-methyl-

5-Iodo-1-methyl-1H-indazole-3-carboxylic acid

Controlled Product

CAS: 1363382-23-3

Please enquire for more information about 5-Iodo-1-methyl-1H-indazole-3-carboxylic acid including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₉H₇IN₂O₂

Purity: Min. 95%

Molecular weight: 302.07 g/mol

Ref: 3D-NEC38223