CAS 1363382-26-6
:Phenylmethyl N-[2-[3,5-bis(trifluoromethyl)phenyl]-1-methyl-2-oxoethyl]carbamate
Description:
Phenylmethyl N-[2-[3,5-bis(trifluoromethyl)phenyl]-1-methyl-2-oxoethyl]carbamate, identified by its CAS number 1363382-26-6, is a synthetic organic compound characterized by its complex structure, which includes a carbamate functional group. This compound features a phenylmethyl moiety and a substituent that contains a trifluoromethylated phenyl group, contributing to its unique chemical properties. The presence of trifluoromethyl groups typically enhances lipophilicity and can influence biological activity, making such compounds of interest in pharmaceutical research. The molecule's structure suggests potential applications in medicinal chemistry, particularly in the development of agrochemicals or pharmaceuticals. Its stability, solubility, and reactivity would depend on the specific conditions, such as pH and temperature, as well as the presence of other reactive species. As with many fluorinated compounds, it may exhibit distinct environmental behavior and toxicity profiles, necessitating careful handling and assessment in both laboratory and industrial settings.
Formula:C19H15F6NO3
InChI:InChI=1S/C19H15F6NO3/c1-11(26-17(28)29-10-12-5-3-2-4-6-12)16(27)13-7-14(18(20,21)22)9-15(8-13)19(23,24)25/h2-9,11H,10H2,1H3,(H,26,28)
InChI key:InChIKey=ICVQXOOPOAIZIA-UHFFFAOYSA-N
SMILES:C(C(NC(OCC1=CC=CC=C1)=O)C)(=O)C2=CC(C(F)(F)F)=CC(C(F)(F)F)=C2
Synonyms:- Phenylmethyl N-[2-[3,5-bis(trifluoromethyl)phenyl]-1-methyl-2-oxoethyl]carbamate
- Carbamic acid, N-[2-[3,5-bis(trifluoromethyl)phenyl]-1-methyl-2-oxoethyl]-, phenylmethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
BENZYL [2-(3,5-BIS(TRIFLUOROMETHYL)PHENYL)-1-METHYL-2-oxo-ETHYL]CARBAMATE
CAS:Formula:C19H15F6NO3Molecular weight:419.3177
