CAS 1363382-87-9

1,1-Dimethylethyl N-(3-azabicyclo[3.1.1]hept-6-ylmethyl)carbamate

Description:

1,1-Dimethylethyl N-(3-azabicyclo[3.1.1]hept-6-ylmethyl)carbamate, identified by its CAS number 1363382-87-9, is a chemical compound characterized by its unique structural features, including a carbamate functional group and a bicyclic amine moiety. This compound typically exhibits properties associated with both the carbamate and bicyclic structures, such as potential biological activity and solubility characteristics influenced by its polar and nonpolar regions. The presence of the dimethyl group contributes to steric hindrance, which may affect its reactivity and interaction with biological targets. Additionally, the bicyclic structure may impart rigidity, influencing the compound's conformational dynamics. Such compounds are often studied for their pharmacological properties, including potential applications in medicinal chemistry. However, specific data regarding its toxicity, stability, and reactivity would require further investigation through experimental studies or literature reviews. Overall, this compound represents a class of molecules that may have significant implications in drug design and development.

Formula: C₁₂H₂₂N₂O₂

InChI: InChI=1S/C12H22N2O2/c1-12(2,3)16-11(15)14-7-10-8-4-9(10)6-13-5-8/h8-10,13H,4-7H2,1-3H3,(H,14,15)

InChI key: InChIKey=XMGLCYSYJLJFDK-UHFFFAOYSA-N

SMILES: C(NC(OC(C)(C)C)=O)C1C2CC1CNC2

Synonyms:

• Carbamic acid, N-(3-azabicyclo[3.1.1]hept-6-ylmethyl)-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl N-(3-azabicyclo[3.1.1]hept-6-ylmethyl)carbamate

6-(BOC-AMINOMETHYL)-3-AZABICYCLO[3.1.1]HEPTANE

CAS: 1363382-87-9

Formula: C₁₂H₂₂N₂O₂

Purity: 95.0%

Molecular weight: 226.32

Ref: 10-F503202