CAS 1363382-90-4

2-Oxa-5,8-diazaspiro[3.5]nonane

Description:

2-Oxa-5,8-diazaspiro[3.5]nonane is a heterocyclic organic compound characterized by its unique spirocyclic structure, which incorporates both nitrogen and oxygen atoms within its framework. The compound features a spiro arrangement, meaning it consists of two rings that share a single atom, contributing to its three-dimensional conformation. The presence of two nitrogen atoms and one oxygen atom in the ring system imparts specific chemical properties, such as potential basicity and reactivity with electrophiles. This compound may exhibit interesting biological activities due to its structural features, making it a candidate for further research in medicinal chemistry. Additionally, its synthesis and characterization would typically involve methods such as cyclization reactions and spectroscopic techniques to confirm its structure. The compound's solubility, stability, and reactivity can vary based on the functional groups present and the overall molecular environment. As with many heterocycles, it may also participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions, which could be relevant in the development of new materials or pharmaceuticals.

Formula: C₆H₁₂N₂O

InChI: InChI=1S/C6H12N2O/c1-2-8-6(3-7-1)4-9-5-6/h7-8H,1-5H2

InChI key: InChIKey=SDYCEPNUOZPFMG-UHFFFAOYSA-N

SMILES: C12(COC1)CNCCN2

Synonyms:

• 2-Oxa-5,8-diazaspiro[3.5]nonane