CAS 1363382-93-7

3-Methyl-1H-pyrrolo[2,3-b]pyridine-5-carboxylic acid

Description:

3-Methyl-1H-pyrrolo[2,3-b]pyridine-5-carboxylic acid is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. This compound features a carboxylic acid functional group, which enhances its acidity and solubility in polar solvents. The presence of the methyl group at the 3-position of the pyrrole ring influences its reactivity and steric properties. As a member of the pyrrolopyridine family, it may exhibit biological activity, making it of interest in medicinal chemistry and drug development. The compound's structure allows for potential interactions with biological targets, which could lead to applications in pharmaceuticals. Additionally, its molecular framework may facilitate various synthetic transformations, making it a valuable intermediate in organic synthesis. Overall, 3-Methyl-1H-pyrrolo[2,3-b]pyridine-5-carboxylic acid is notable for its structural complexity and potential utility in chemical research and development.

Formula: C₉H₈N₂O₂

InChI: InChI=1S/C9H8N2O2/c1-5-3-10-8-7(5)2-6(4-11-8)9(12)13/h2-4H,1H3,(H,10,11)(H,12,13)

InChI key: InChIKey=WZWMYWSNNVONBA-UHFFFAOYSA-N

SMILES: CC=1C=2C(=NC=C(C(O)=O)C2)NC1

Synonyms:

• 1H-Pyrrolo[2,3-b]pyridine-5-carboxylic acid, 3-methyl-
• 3-Methyl-1H-pyrrolo[2,3-b]pyridine-5-carboxylic acid