CAS 1363383-00-9

Imidazo[2,1-f][1,2,4]triazin-4-amine

Description:

Imidazo[2,1-f][1,2,4]triazin-4-amine is a heterocyclic compound characterized by its fused imidazole and triazine rings, which contribute to its unique chemical properties. This compound typically exhibits a planar structure, allowing for potential interactions with biological targets. It contains amino functional groups, which can participate in hydrogen bonding and enhance its solubility in polar solvents. The presence of nitrogen atoms in the ring structure often imparts basicity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Additionally, its structural features may confer biological activity, making it of interest in medicinal chemistry for the development of pharmaceuticals. The compound's stability and reactivity can be influenced by substituents on the ring, which can modulate its electronic properties. Overall, Imidazo[2,1-f][1,2,4]triazin-4-amine represents a versatile scaffold in organic synthesis and drug discovery, with potential applications in various fields, including agrochemicals and materials science.

Formula: C₅H₅N₅

InChI: InChI=1S/C5H5N5/c6-4-5-7-1-2-10(5)9-3-8-4/h1-3H,(H2,6,8,9)

InChI key: InChIKey=UPNQEWDYUUWWGH-UHFFFAOYSA-N

SMILES: NC=1C=2N(N=CN1)C=CN2

Synonyms:

• Imidazo[2,1-f][1,2,4]triazin-4-amine

Imidazo[2,1-f][1,2,4]triazin-4-amine

CAS: 1363383-00-9

Formula: C₅H₅N₅

Purity: 97%

Color and Shape: Solid

Molecular weight: 135.1267

Ref: IN-DA0011QP

Imidazo[2,1-f][1,2,4]triazin-4-amine

CAS: 1363383-00-9

Imidazo[2,1-f][1,2,4]triazin-4-amine

Purity: 97%

Molecular weight: 135.13g/mol

Ref: 54-OR1036347

4-AMINOIMIDAZO[2,1-F][1,2,4]TRIAZINE

CAS: 1363383-00-9

Formula: C₅H₅N₅

Purity: 97%

Molecular weight: 135.13

Ref: 10-F467990

imidazo[2,1-f][1,2,4]triazin-4-amine

CAS: 1363383-00-9

Imidazo[2,1-f][1,2,4]triazin-4-amine is a synthetic nucleoside analogue that is used in the treatment of chronic hepatitis C. It has been shown to inhibit the replication of human immunodeficiency virus (HIV) and hepatitis B virus (HBV). Imidazo[2,1-f][1,2,4]triazin-4-amine inhibits the adenosine deaminase enzyme and the formation of monophosphate derivatives of adenosine. This leads to an increased concentration of adenosine in cells, which blocks the function of purine receptors on hepatocytes. Furthermore, imidazo[2,1-f][1,2,4]triazin-4-amine inhibits viral DNA polymerase by interacting with its active site. The antiviral activity is thought to be due to imidazo[2,1-f][1,2,

Formula: C₅H₅N₅

Purity: Min. 95%

Molecular weight: 135.13 g/mol

Ref: 3D-NEC38300