CAS 1363383-04-3

5-Bromo-1-methyl-7-nitro-1H-indazole

Description:

5-Bromo-1-methyl-7-nitro-1H-indazole is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of a bromine atom at the 5-position and a nitro group at the 7-position contributes to its reactivity and potential applications in various fields, including medicinal chemistry and material science. The methyl group at the 1-position enhances its lipophilicity, which can influence its biological activity and solubility. This compound may exhibit interesting pharmacological properties, making it a subject of research in drug development. Its molecular structure allows for various interactions with biological targets, potentially leading to therapeutic effects. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the bromine and nitro substituents. Overall, 5-Bromo-1-methyl-7-nitro-1H-indazole is a notable compound with diverse applications, particularly in the synthesis of other chemical entities and in biological research.

Formula: C₈H₆BrN₃O₂

InChI: InChI=1S/C8H6BrN3O2/c1-11-8-5(4-10-11)2-6(9)3-7(8)12(13)14/h2-4H,1H3

InChI key: InChIKey=MKYFJOZCRQIMLH-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=C2C(C=NN2C)=CC(Br)=C1

Synonyms:

• 5-Bromo-1-methyl-7-nitro-1H-indazole
• 1H-Indazole, 5-bromo-1-methyl-7-nitro-