CymitQuimica logo

CAS 1363383-09-8

:

7-Bromopyrazolo[1,5-a]pyridine-2-carboxylic acid

Description:
7-Bromopyrazolo[1,5-a]pyridine-2-carboxylic acid is a heterocyclic organic compound characterized by its pyrazolo and pyridine ring systems, which contribute to its unique chemical properties. The presence of a bromine atom at the 7-position enhances its reactivity and potential for substitution reactions. This compound features a carboxylic acid functional group, which imparts acidic characteristics and allows for hydrogen bonding, influencing its solubility and interaction with biological systems. Typically, compounds of this nature are of interest in medicinal chemistry due to their potential pharmacological activities, including anti-inflammatory and anti-cancer properties. The molecular structure suggests that it may participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions, making it a valuable intermediate in synthetic organic chemistry. Additionally, its specific CAS number, 1363383-09-8, allows for precise identification and retrieval of data related to its properties, safety, and applications in research and industry.
Formula:C8H5BrN2O2
InChI:InChI=1S/C8H5BrN2O2/c9-7-3-1-2-5-4-6(8(12)13)10-11(5)7/h1-4H,(H,12,13)
InChI key:InChIKey=QZLGYHSVPBZFIP-UHFFFAOYSA-N
SMILES:BrC=1N2C(=CC(C(O)=O)=N2)C=CC1
Found 2 products.