CAS 1363383-15-6

1H-Pyrazolo[4,3-b]pyridine-7-carboxylic acid

Description:

1H-Pyrazolo[4,3-b]pyridine-7-carboxylic acid is a heterocyclic organic compound characterized by its fused pyrazole and pyridine rings, which contribute to its unique chemical properties. This compound features a carboxylic acid functional group, enhancing its acidity and making it a potential candidate for various chemical reactions, including esterification and amidation. The presence of nitrogen atoms in the ring structure can influence its reactivity and interactions with biological systems, suggesting potential applications in medicinal chemistry. Additionally, the compound's structural features may allow for hydrogen bonding and coordination with metal ions, which could be relevant in catalysis or material science. Its specific properties, such as solubility, melting point, and stability, can vary depending on the environment and conditions, making it important for researchers to consider these factors in practical applications. Overall, 1H-Pyrazolo[4,3-b]pyridine-7-carboxylic acid represents a versatile scaffold for further chemical exploration and development in various fields.

Formula: C₇H₅N₃O₂

InChI: InChI=1S/C7H5N3O2/c11-7(12)4-1-2-8-5-3-9-10-6(4)5/h1-3H,(H,9,10)(H,11,12)

InChI key: InChIKey=HVSPPWYGWIPSMX-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C2C(C=NN2)=NC=C1

Synonyms:

• 1H-Pyrazolo[4,3-b]pyridine-7-carboxylic acid

1H-Pyrazolo[4,3-b]pyridine-7-carboxylic acid

CAS: 1363383-15-6

Formula: C₇H₅N₃O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 163.1335

Ref: IN-DA0011QG

1H-PYRAZOLO[4,3-B]PYRIDINE-7-CARBOXYLIC ACID

CAS: 1363383-15-6

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 163.13600158691406

Ref: 10-F503452

1H-pyrazolo[4,3-b]pyridine-7-carboxylic acid

CAS: 1363383-15-6

Versatile small molecule scaffold

Formula: C₇H₅N₃O₂

Purity: Min. 95%

Molecular weight: 163.13 g/mol

Ref: 3D-NEC38315