CAS 1363383-39-4
:1-Phenyl-1,6-diazaspiro[3.3]heptane
Description:
1-Phenyl-1,6-diazaspiro[3.3]heptane is a bicyclic compound characterized by its unique spiro structure, which consists of a seven-membered ring fused with a phenyl group and two nitrogen atoms incorporated into the framework. This compound exhibits properties typical of spirocyclic amines, including potential basicity due to the presence of nitrogen atoms, which can participate in protonation reactions. The spiro configuration contributes to its three-dimensional shape, influencing its reactivity and interactions with other molecules. Additionally, the phenyl group can enhance the compound's lipophilicity, potentially affecting its solubility in organic solvents. The presence of nitrogen atoms may also allow for hydrogen bonding, which can influence its physical properties such as boiling and melting points. Overall, 1-Phenyl-1,6-diazaspiro[3.3]heptane is of interest in medicinal chemistry and material science due to its structural complexity and potential biological activity. Further studies would be necessary to fully elucidate its chemical behavior and applications.
Formula:C11H14N2
InChI:InChI=1S/C11H14N2/c1-2-4-10(5-3-1)13-7-6-11(13)8-12-9-11/h1-5,12H,6-9H2
InChI key:InChIKey=QWFHWOXJGVJQIE-UHFFFAOYSA-N
SMILES:C12(N(CC1)C3=CC=CC=C3)CNC2
Synonyms:- 1-Phenyl-1,6-diazaspiro[3.3]heptane
- 1,6-Diazaspiro[3.3]heptane, 1-phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
