CAS 1363384-65-9

4,4-Difluoro-2-methyl-L-proline

Description:

4,4-Difluoro-2-methyl-L-proline is a fluorinated amino acid derivative characterized by the presence of two fluorine atoms at the 4-position and a methyl group at the 2-position of the proline ring. This compound is notable for its potential applications in medicinal chemistry, particularly in the design of pharmaceuticals due to its ability to influence the conformation and stability of peptide structures. The introduction of fluorine atoms can enhance the lipophilicity and metabolic stability of compounds, making them more effective in biological systems. Additionally, the presence of the L-proline backbone contributes to its role in protein synthesis and folding. The compound is typically synthesized through specific organic reactions that allow for the selective introduction of fluorine and methyl groups. Its unique structural features may also provide insights into the development of new therapeutic agents, particularly in the context of targeting specific biological pathways or receptors. As with many fluorinated compounds, careful consideration of its environmental and biological impact is essential in its application.

Formula: C₆H₉F₂NO₂

InChI: InChI=1S/C6H9F2NO2/c1-5(4(10)11)2-6(7,8)3-9-5/h9H,2-3H2,1H3,(H,10,11)/t5-/m0/s1

InChI key: InChIKey=VUQFCVHLMDDEJL-YFKPBYRVSA-N

SMILES: C(O)(=O)[C@]1(C)CC(F)(F)CN1

Synonyms:

• 4,4-Difluoro-2-methyl-L-proline
• (S)-4,4-Difluoro-2-methylpyrrolidine-2-carboxylic acid
• L-Proline, 4,4-difluoro-2-methyl-
• (2S)-4,4-Difluoro-2-methylpyrrolidine-2-carboxylic acid