
CAS 13634-89-4
:4-Methyl-2,3,5,6-tetrafluorothiophenol
Description:
4-Methyl-2,3,5,6-tetrafluorothiophenol is an organofluorine compound characterized by the presence of a thiol group (-SH) and multiple fluorine substituents on a thiophenol ring. The molecular structure features a methyl group and four fluorine atoms attached to the aromatic thiophenol framework, which significantly influences its chemical properties. This compound is typically a solid at room temperature and exhibits a distinct odor. Its fluorinated nature enhances its stability and lipophilicity, making it useful in various applications, including as a reagent in organic synthesis and in the development of pharmaceuticals. The presence of the thiol group allows for potential reactivity in nucleophilic substitution reactions. Additionally, the compound's fluorine atoms can impart unique electronic properties, affecting its reactivity and interaction with other chemical species. Safety precautions should be taken when handling this substance, as it may pose health risks, including skin and respiratory irritation. Overall, 4-Methyl-2,3,5,6-tetrafluorothiophenol is a valuable compound in the field of synthetic chemistry and materials science.
Formula:C7H3F4S
InChI:InChI=1/C7H4F4S/c1-2-3(8)5(10)7(12)6(11)4(2)9/h12H,1H3/p-1
SMILES:Cc1c(c(c(c(c1F)F)[S-])F)F
Synonyms:- 2,3,5,6-Tetrafluoro-4-methylbenzenethiol
- 2,3,5,6-Tetrafluoro-4-methylthiophenol
- 2,3,5,6-Tetrafluoro-4-Methylbenzenethiolate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
