CAS 13634-93-0
:4-CHLORO-TETRAFLUOROTHIOPHENOL
Description:
4-Chloro-tetrafluorothiophenol, with the CAS number 13634-93-0, is a chemical compound characterized by the presence of a thiophenol structure substituted with a chlorine atom and four fluorine atoms. This compound typically exhibits a pale yellow to light brown appearance and is known for its distinct odor. The presence of the chlorine and fluorine substituents significantly influences its chemical properties, including increased electronegativity and potential reactivity. It is generally soluble in organic solvents but may have limited solubility in water due to its hydrophobic characteristics. The compound is of interest in various chemical applications, including as a reagent in organic synthesis and in the development of specialty chemicals. Additionally, its unique electronic properties may make it suitable for use in materials science and as a potential intermediate in the synthesis of more complex molecules. Safety precautions should be observed when handling this compound, as it may pose health risks due to its chemical nature.
Formula:C6HClF4S
InChI:InChI=1/C6HClF4S/c7-1-2(8)4(10)6(12)5(11)3(1)9/h12H
SMILES:c1(c(c(c(c(c1F)F)S)F)F)Cl
Synonyms:- 4-Chloro-Tetrafluorothiophenol 97%
- 4-Chloro-2,3,5,6-Tetrafluorobenzenethiol
- 4-CHLORO-TETRAFLUOROTHIOPHENOL
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
4-Chloro-Tetrafluorothiophenol
CAS:4-Chloro-Tetrafluorothiophenol is a chemical that is used to produce polymers. It has been found to be effective at maximizing the coefficient of thermal expansion, which leads to improved elasticity and toughness in polymers. 4-Chloro-Tetrafluorothiophenol can be used as a metal salt or a vapor, and it has an effect on flexural properties when combined with fatty acids. This chemical has been neutralized in order to produce acid salts for use as polymer additives. 4-Chloro-Tetrafluorothiophenol also reacts with peroxide to form organosulfur compounds.Formula:C6HClF4SPurity:Min. 97 Area-%Color and Shape:White To Light (Or Pale) Beige Pink SolidMolecular weight:216.58 g/mol

