
CAS 1363404-74-3
:3-Amino-2-(2-methylphenyl)pyrido[2,3-d]pyrimidin-4(3H)-one
Description:
3-Amino-2-(2-methylphenyl)pyrido[2,3-d]pyrimidin-4(3H)-one is a heterocyclic organic compound characterized by its complex structure, which includes a pyrido-pyrimidine core. This compound features an amino group and a 2-methylphenyl substituent, contributing to its potential biological activity. The presence of nitrogen atoms in the pyrido and pyrimidine rings often imparts unique chemical properties, such as the ability to participate in hydrogen bonding and coordination with metal ions. The compound may exhibit various pharmacological activities, making it of interest in medicinal chemistry. Its solubility, stability, and reactivity can be influenced by the functional groups present, and it may undergo typical organic reactions such as nucleophilic substitutions or electrophilic additions. Additionally, the compound's molecular geometry and electronic distribution can affect its interactions with biological targets, which is crucial for drug design and development. Overall, 3-Amino-2-(2-methylphenyl)pyrido[2,3-d]pyrimidin-4(3H)-one represents a class of compounds that could have significant implications in pharmaceutical research.
Formula:C14H12N4O
InChI:InChI=1S/C14H12N4O/c1-9-5-2-3-6-10(9)13-17-12-11(7-4-8-16-12)14(19)18(13)15/h2-8H,15H2,1H3
InChI key:InChIKey=CXKQOZFUQFAMCN-UHFFFAOYSA-N
SMILES:NN1C(=NC=2C(C1=O)=CC=CN2)C3=C(C)C=CC=C3
Synonyms:- Pyrido[2,3-d]pyrimidin-4(3H)-one, 3-amino-2-(2-methylphenyl)-
- 3-Amino-2-(2-methylphenyl)pyrido[2,3-d]pyrimidin-4(3H)-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.