CAS 1363404-79-8

6-(Bromomethyl)-2,4-dichloropyrido[3,2-d]pyrimidine

Description:

6-(Bromomethyl)-2,4-dichloropyrido[3,2-d]pyrimidine is a heterocyclic organic compound characterized by its complex structure, which includes a pyridine and pyrimidine ring system. This compound features bromomethyl and dichloro substituents, contributing to its reactivity and potential applications in medicinal chemistry. The presence of halogen atoms, specifically bromine and chlorine, often enhances the compound's biological activity and can influence its solubility and stability. The molecular structure suggests that it may participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions, making it a valuable intermediate in the synthesis of pharmaceuticals or agrochemicals. Additionally, the compound's unique arrangement of nitrogen and carbon atoms may impart specific electronic properties, which can be exploited in the development of targeted therapies or as a building block for more complex molecules. Overall, 6-(Bromomethyl)-2,4-dichloropyrido[3,2-d]pyrimidine is of interest in research and development due to its potential utility in various chemical and biological applications.

Formula: C₈H₄BrCl₂N₃

InChI: InChI=1S/C8H4BrCl2N3/c9-3-4-1-2-5-6(12-4)7(10)14-8(11)13-5/h1-2H,3H2

InChI key: InChIKey=QDWMKWZQQVOPQR-UHFFFAOYSA-N

SMILES: ClC=1C2=C(N=C(Cl)N1)C=CC(CBr)=N2

Synonyms:

• Pyrido[3,2-d]pyrimidine, 6-(bromomethyl)-2,4-dichloro-
• 6-(Bromomethyl)-2,4-dichloropyrido[3,2-d]pyrimidine