CAS 1363405-08-6

4-(3,4-Dichlorophenyl)-1-(phenylmethyl)-3-pyrrolidinamine

Description:

4-(3,4-Dichlorophenyl)-1-(phenylmethyl)-3-pyrrolidinamine, identified by its CAS number 1363405-08-6, is a chemical compound that belongs to the class of pyrrolidine derivatives. This substance features a pyrrolidine ring substituted with a phenylmethyl group and a dichlorophenyl moiety, which contributes to its unique chemical properties. The presence of chlorine atoms on the aromatic ring enhances its lipophilicity and may influence its biological activity. Typically, compounds of this nature are studied for their potential pharmacological effects, including their role as intermediates in drug synthesis or as active pharmaceutical ingredients. The molecular structure suggests that it may exhibit interactions with various biological targets, potentially leading to therapeutic applications. However, specific characteristics such as solubility, stability, and reactivity would depend on the compound's environment and conditions. As with many organic compounds, safety and handling precautions are essential due to potential toxicity or reactivity. Further research would be necessary to fully elucidate its properties and applications in medicinal chemistry.

Formula: C₁₇H₁₈Cl₂N₂

InChI: InChI=1S/C17H18Cl2N2/c18-15-7-6-13(8-16(15)19)14-10-21(11-17(14)20)9-12-4-2-1-3-5-12/h1-8,14,17H,9-11,20H2

InChI key: InChIKey=ADKBAMYNQIJAOF-UHFFFAOYSA-N

SMILES: NC1C(CN(CC2=CC=CC=C2)C1)C3=CC(Cl)=C(Cl)C=C3

Synonyms:

• 4-(3,4-Dichlorophenyl)-1-(phenylmethyl)-3-pyrrolidinamine
• 3-Pyrrolidinamine, 4-(3,4-dichlorophenyl)-1-(phenylmethyl)-