CymitQuimica logo

CAS 1363405-09-7

:

1-(3-Oxetanyl)-4-piperidinamindihydrochlorid

Description:
1-(3-Oxetanyl)-4-piperidinamindihydrochlorid, identified by its CAS number 1363405-09-7, is a chemical compound that features a piperidine ring substituted with an oxetane moiety. The presence of the oxetane ring contributes to its unique structural properties, potentially influencing its reactivity and interaction with biological systems. As a dihydrochloride salt, it is likely to exhibit enhanced solubility in aqueous environments, which is a common characteristic of many hydrochloride salts. This compound may possess pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of therapeutic agents. Its specific characteristics, such as melting point, boiling point, and spectral data, would typically be determined through experimental methods. Additionally, the compound's safety profile, including toxicity and handling precautions, would be essential for practical applications. Overall, 1-(3-Oxetanyl)-4-piperidinamindihydrochlorid represents a class of compounds that may have significant implications in drug discovery and development.
Formula:C8H18Cl2N2O
InChI:InChI=1S/C8H16N2O.2ClH/c9-7-1-3-10(4-2-7)8-5-11-6-8;;/h7-8H,1-6,9H2;2*1H
InChI key:CCDQQELWWDIHMI-UHFFFAOYSA-N
SMILES:C1CN(CCC1N)C2COC2.Cl.Cl
Found 4 products.