CymitQuimica logo

CAS 1363405-30-4

:

Octahydro-8-phenyl-8-indolizinamine

Description:
Octahydro-8-phenyl-8-indolizinamine, identified by its CAS number 1363405-30-4, is a chemical compound that belongs to the class of indolizinamines. This substance features a bicyclic structure that includes an indolizine moiety, which is characterized by a fused ring system containing nitrogen. The presence of the phenyl group contributes to its aromatic properties, potentially influencing its reactivity and interactions with other molecules. Typically, compounds of this nature may exhibit biological activity, making them of interest in medicinal chemistry and pharmacology. The saturation of the octahydro portion indicates that the compound is likely to be less reactive than its unsaturated counterparts, which can affect its stability and solubility in various solvents. Additionally, the specific arrangement of functional groups and stereochemistry can significantly impact its pharmacokinetic and pharmacodynamic properties. Overall, Octahydro-8-phenyl-8-indolizinamine represents a unique structure that may have potential applications in drug development or as a research tool in chemical biology.
Formula:C14H20N2
InChI:InChI=1S/C14H20N2/c15-14(12-6-2-1-3-7-12)9-5-11-16-10-4-8-13(14)16/h1-3,6-7,13H,4-5,8-11,15H2
InChI key:InChIKey=ROECKPIOTAYTTF-UHFFFAOYSA-N
SMILES:NC1(C2N(CCC1)CCC2)C3=CC=CC=C3
Synonyms:
  • Octahydro-8-phenyl-8-indolizinamine
  • 8-Indolizinamine, octahydro-8-phenyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.