CAS 1363405-31-5

4-Chloro-7-(1,1-dimethylethyl)pyrazolo[1,5-a]-1,3,5-triazine

Description:

4-Chloro-7-(1,1-dimethylethyl)pyrazolo[1,5-a]-1,3,5-triazine is a heterocyclic compound characterized by its pyrazolo-triazine structure, which incorporates both pyrazole and triazine rings. This compound features a chlorine atom at the 4-position and a tert-butyl group at the 7-position, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of the chlorine atom can influence its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. The tert-butyl group enhances its steric bulk, which can affect its interaction with biological targets or other chemical species. This compound may have applications in agrochemicals or pharmaceuticals, particularly in the development of herbicides or other bioactive agents. As with many heterocycles, its stability and reactivity can be influenced by environmental factors such as pH and temperature, making it important to consider these conditions in practical applications.

Formula: C₉H₁₁ClN₄

InChI: InChI=1S/C9H11ClN4/c1-9(2,3)6-4-7-11-5-12-8(10)14(7)13-6/h4-5H,1-3H3

InChI key: InChIKey=HTCTWYWOBUVGME-UHFFFAOYSA-N

SMILES: ClC=1N2C(=CC(C(C)(C)C)=N2)N=CN1

Synonyms:

• 4-Chloro-7-(1,1-dimethylethyl)pyrazolo[1,5-a]-1,3,5-triazine
• Pyrazolo[1,5-a]-1,3,5-triazine, 4-chloro-7-(1,1-dimethylethyl)-