CAS 1363405-41-7

Cyclopentaneacetonitrile, 1-amino-, hydrochloride (1:1)

Description:

Cyclopentaneacetonitrile, 1-amino-, hydrochloride (1:1) is a chemical compound characterized by its amine functional group and the presence of a hydrochloride salt. This substance typically appears as a white to off-white crystalline solid. It is soluble in water and polar organic solvents, which is common for hydrochloride salts due to their ionic nature. The compound is likely to exhibit basic properties due to the amino group, allowing it to participate in various chemical reactions, including nucleophilic substitutions and acid-base reactions. Its structure suggests potential applications in organic synthesis, pharmaceuticals, or as an intermediate in chemical manufacturing. Safety data should be consulted, as with any chemical, to understand its handling, storage, and potential hazards. Overall, Cyclopentaneacetonitrile, 1-amino-, hydrochloride (1:1) is a specialized compound with specific characteristics that may be relevant in various scientific and industrial contexts.

Formula: C₇H₁₂N₂·ClH

InChI: InChI=1S/C7H12N2.ClH/c8-6-5-7(9)3-1-2-4-7;/h1-5,9H2;1H

InChI key: InChIKey=MAFFUDHWXNCVQO-UHFFFAOYSA-N

SMILES: C(C#N)C1(N)CCCC1.Cl

Synonyms:

• Cyclopentaneacetonitrile, 1-amino-, hydrochloride (1:1)

2-(1-Aminocyclopentyl)acetonitrile hcl

CAS: 1363405-41-7

Formula: C₇H₁₃ClN₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 160.6445

Ref: IN-DA00IMN1

2-(1-Aminocyclopentyl)acetonitrile hydrochloride

CAS: 1363405-41-7

2-(1-Aminocyclopentyl)acetonitrile hydrochloride

Purity: 95%

Molecular weight: 160.65g/mol

Ref: 54-OR1045287

2-(1-AMINOCYCLOPENTYL)ACETONITRILE HCL

CAS: 1363405-41-7

Formula: C₇H₁₃ClN₂

Purity: 95%

Molecular weight: 160.65

Ref: 10-F302202