CAS 1363405-51-9

Ethyl 6-iodo-3-benzofurancarboxylate

Description:

Ethyl 6-iodo-3-benzofurancarboxylate is a chemical compound characterized by its unique structure, which includes a benzofuran moiety and an ethyl ester functional group. The presence of the iodine atom at the 6-position of the benzofuran ring contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. This compound typically exhibits moderate solubility in organic solvents, reflecting its aromatic nature, while being less soluble in polar solvents due to the hydrophobic characteristics of the benzofuran structure. Ethyl 6-iodo-3-benzofurancarboxylate may participate in various chemical reactions, such as nucleophilic substitutions and coupling reactions, making it a valuable intermediate in the synthesis of more complex organic molecules. Its potential biological activity, stemming from the benzofuran framework, warrants further investigation, particularly in the context of drug discovery and development. As with many halogenated compounds, safety precautions should be observed when handling this substance due to the potential for toxicity and environmental impact.

Formula: C₁₁H₉IO₃

InChI: InChI=1S/C11H9IO3/c1-2-14-11(13)9-6-15-10-5-7(12)3-4-8(9)10/h3-6H,2H2,1H3

InChI key: InChIKey=OFRWVMXEYADRKB-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C=1C=2C(OC1)=CC(I)=CC2

Synonyms:

• 3-Benzofurancarboxylic acid, 6-iodo-, ethyl ester
• Ethyl 6-iodo-3-benzofurancarboxylate