
CAS 1363439-50-2
:4-Iodo-α-(methoxymethyl)benzeneethanamine
Description:
4-Iodo-α-(methoxymethyl)benzeneethanamine, identified by its CAS number 1363439-50-2, is a chemical compound that features a benzene ring substituted with an iodine atom and an ethylamine group. The presence of the methoxymethyl group enhances its reactivity and solubility in organic solvents. This compound is characterized by its potential applications in medicinal chemistry, particularly in the synthesis of pharmaceuticals or as a building block for more complex molecules. The iodine substituent can facilitate various chemical reactions, such as nucleophilic substitutions, while the amine group may participate in hydrogen bonding and act as a site for further functionalization. Additionally, the methoxy group can influence the electronic properties of the molecule, affecting its reactivity and interaction with biological targets. Overall, 4-Iodo-α-(methoxymethyl)benzeneethanamine is a versatile compound with significant implications in organic synthesis and drug development.
Formula:C10H14INO
InChI:InChI=1S/C10H14INO/c1-13-7-10(12)6-8-2-4-9(11)5-3-8/h2-5,10H,6-7,12H2,1H3
InChI key:InChIKey=ZNFDZUJFCFQOSZ-UHFFFAOYSA-N
SMILES:C(C(COC)N)C1=CC=C(I)C=C1
Synonyms:- 4-Iodo-α-(methoxymethyl)benzeneethanamine
- Benzeneethanamine, 4-iodo-α-(methoxymethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.