CAS 136346-26-4
:N-2-fluoroethylketanserin
Description:
N-2-fluoroethylketanserin is a chemical compound that belongs to the class of serotonin receptor antagonists, specifically targeting the 5-HT2A receptor. It is characterized by the presence of a fluorinated ethyl group, which can influence its pharmacological properties and metabolic stability. The compound is typically studied for its potential therapeutic applications, particularly in the context of neurological and psychiatric disorders. Its structure includes a ketanserin backbone, which is known for its antihypertensive and antipsychotic effects. The introduction of the fluorine atom may enhance lipophilicity and alter the compound's interaction with biological targets. As with many pharmacologically active substances, understanding its solubility, stability, and bioavailability is crucial for evaluating its efficacy and safety in clinical settings. Additionally, the compound's synthesis and characterization involve standard organic chemistry techniques, and its behavior in biological systems is often assessed through in vitro and in vivo studies. Overall, N-2-fluoroethylketanserin represents a compound of interest in medicinal chemistry and pharmacology.
Formula:C24H2518F2N3O3
InChI:InChI=1/C24H25F2N3O3/c25-11-14-28-21-4-2-1-3-20(21)23(31)29(24(28)32)16-15-27-12-9-18(10-13-27)22(30)17-5-7-19(26)8-6-17/h1-8,18H,9-16H2/i25-1,26-1
SMILES:c1ccc2c(c1)c(=O)n(CCN1CCC(CC1)C(=O)c1ccc(cc1)[18F])c(=O)n2CC[18F]
Synonyms:- Ffek
- 2,4(1H,3H)-Quinazolinedione, 3-(2-(4-(4-fluorobenzoyl)-1-piperidinyl)ethyl)-1-(2-(fluoro-18F)ethyl)-
- 1-[2-(~18~F)fluoroethyl]-3-[2-(4-{[4-(~18~F)fluorophenyl]carbonyl}piperidin-1-yl)ethyl]quinazoline-2,4(1H,3H)-dione
- N-2-Fluoroethylketanserin
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.