CAS 13636-33-4
:N′-(3,4-Dichlorophenyl)-N,N-dimethylguanidine
Description:
N′-(3,4-Dichlorophenyl)-N,N-dimethylguanidine, identified by its CAS number 13636-33-4, is a chemical compound that belongs to the class of guanidines. It is characterized by the presence of a guanidine functional group, which is notable for its basicity and ability to form hydrogen bonds. The compound features a dichlorophenyl group, which contributes to its hydrophobic characteristics and may influence its biological activity. Typically, guanidine derivatives are known for their applications in various fields, including pharmaceuticals and agrochemicals. The presence of chlorine atoms in the phenyl ring can enhance the compound's lipophilicity and potentially its reactivity. Additionally, N,N-dimethyl substitution provides steric hindrance, which may affect the compound's interaction with biological targets. Overall, this compound's unique structure suggests potential utility in medicinal chemistry, although specific applications would depend on further research into its biological properties and mechanisms of action.
Formula:C9H11Cl2N3
InChI:InChI=1S/C9H11Cl2N3/c1-14(2)9(12)13-6-3-4-7(10)8(11)5-6/h3-5H,1-2H3,(H2,12,13)
InChI key:InChIKey=ZYKHLGBMZVPXEA-UHFFFAOYSA-N
SMILES:N(C(N(C)C)=N)C1=CC(Cl)=C(Cl)C=C1
Synonyms:- Guanidine, 3-(3,4-dichlorophenyl)-1,1-dimethyl-
- Guanidine, N′-(3,4-dichlorophenyl)-N,N-dimethyl-
- Bayer 59,680
- N′-(3,4-Dichlorophenyl)-N,N-dimethylguanidine
- N,N-Dimethyl-N′-3,4-dichlorophenylguanidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
