
CAS 136369-09-0
:4,7-Methano-1H-isoindole-1,3(2H)-dione, 3a,4,7,7a-tetrahydro-2-[2-(1-piperazinyl)ethyl]-, hydrochloride (1:2)
Description:
4,7-Methano-1H-isoindole-1,3(2H)-dione, 3a,4,7,7a-tetrahydro-2-[2-(1-piperazinyl)ethyl]-, hydrochloride (1:2) is a chemical compound characterized by its complex bicyclic structure, which includes an isoindole moiety and a piperazine substituent. This compound typically exhibits properties associated with both the isoindole and piperazine classes, such as potential biological activity, including effects on neurotransmitter systems. The hydrochloride salt form indicates that it is a hydrochloride salt, which often enhances solubility in water and may influence its pharmacokinetic properties. The presence of the piperazine group suggests possible interactions with various receptors, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting central nervous system disorders. Its molecular structure contributes to its stability and reactivity, while the specific arrangement of functional groups can affect its binding affinity and selectivity for biological targets. Overall, this compound represents a unique scaffold for further exploration in drug development and therapeutic applications.
Formula:C15H21N3O2·2ClH
InChI:InChI=1S/C15H21N3O2.2ClH/c19-14-12-10-1-2-11(9-10)13(12)15(20)18(14)8-7-17-5-3-16-4-6-17;;/h1-2,10-13,16H,3-9H2;2*1H
InChI key:InChIKey=UIJYMLDYSRZPGY-UHFFFAOYSA-N
SMILES:O=C1C2C(C3CC2C=C3)C(=O)N1CCN4CCNCC4.Cl
Synonyms:- 4,7-Methano-1H-isoindole-1,3(2H)-dione, 3a,4,7,7a-tetrahydro-2-[2-(1-piperazinyl)ethyl]-, dihydrochloride
- 4,7-Methano-1H-isoindole-1,3(2H)-dione, 3a,4,7,7a-tetrahydro-2-[2-(1-piperazinyl)ethyl]-, hydrochloride (1:2)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.