CAS 13637-83-7
:Chloryl fluoride ((ClO2)F)
Description:
Chloryl fluoride (ClO2F) is a chemical compound characterized by its unique combination of chlorine, oxygen, and fluorine atoms. It is a colorless gas at room temperature and exhibits a pungent odor. Chloryl fluoride is known for its reactivity, particularly as a strong oxidizing agent, which makes it useful in various chemical synthesis processes. The compound is typically stable under standard conditions but can decompose under certain circumstances, releasing toxic gases. It is soluble in organic solvents and can react vigorously with water, producing hydrochloric acid and other products. Due to its reactivity and potential hazards, chloryl fluoride must be handled with care, utilizing appropriate safety measures to prevent exposure. Its applications are primarily found in the fields of organic chemistry and materials science, where it serves as a reagent in the synthesis of fluorinated compounds. Overall, chloryl fluoride is a significant compound in specialized chemical applications, but its handling requires strict adherence to safety protocols due to its toxic and corrosive nature.
Formula:ClFO2
InChI:InChI=1S/ClFO2/c2-1(3)4
InChI key:InChIKey=YVRLYFHVJLYEHM-UHFFFAOYSA-N
SMILES:Cl(F)(=O)=O
Synonyms:- Chloryl fluoride (ClFO2)
- Chloryl fluoride
- Chloryl fluoride ((ClO2)F)
- Dioxychlorofluoride
- Chlorine fluoride oxide (ClO2F)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
