CAS 13637-87-1
:Nitrogen chloride fluoride (NClF2)
Description:
Nitrogen chloride fluoride (NClF2) is a chemical compound characterized by its unique combination of nitrogen, chlorine, and fluorine atoms. It is a colorless gas at room temperature and exhibits a pungent odor. NClF2 is known for its reactivity, particularly as a halogenated nitrogen compound, which can participate in various chemical reactions, including those involving halogen exchange. The presence of both chlorine and fluorine in its structure contributes to its potential as a fluorinating agent. This compound is typically handled with caution due to its toxic and corrosive nature, which can pose health risks upon exposure. In terms of stability, NClF2 can decompose under certain conditions, releasing toxic gases. Its applications may include use in specialized chemical synthesis and research, particularly in the development of new materials or in the field of fluorine chemistry. As with all chemical substances, proper safety protocols should be followed when working with nitrogen chloride fluoride to mitigate any hazards associated with its use.
Formula:ClF2N
InChI:InChI=1S/ClF2N/c1-4(2)3
InChI key:InChIKey=ZIOUHCMXEAFYSA-UHFFFAOYSA-N
SMILES:N(Cl)(F)F
Synonyms:- Chlorodifluoramine
- Difluorochloroamine
- Nitrogen chloride difluoride
- Nitrogen chloride fluoride (NClF2)
- Chlorodifluoroammonia
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
