CAS 136370-19-9
:4-(N-HEPTYLOXY)BENZENEBORONIC ACID
Description:
4-(N-Heptyloxy)benzeneboronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that is further substituted with a heptyloxy group. This compound typically exhibits properties such as moderate solubility in organic solvents and limited solubility in water, which is common for alkyl-substituted boronic acids. The heptyloxy group enhances its hydrophobic characteristics, making it useful in various organic synthesis applications, particularly in the development of materials and pharmaceuticals. The boronic acid moiety allows for reversible covalent bonding with diols, making it valuable in sensing applications and in the formation of boronate esters. Additionally, this compound may participate in Suzuki coupling reactions, a key method in organic chemistry for forming carbon-carbon bonds. Its structural features contribute to its potential utility in organic electronics, drug delivery systems, and as a building block in the synthesis of more complex molecules.
Formula:C13H21BO3
InChI:InChI=1/C13H21BO3/c1-2-3-4-5-6-11-17-13-9-7-12(8-10-13)14(15)16/h7-10,15-16H,2-6,11H2,1H3
SMILES:CCCCCCCOc1ccc(cc1)B(O)O
Synonyms:- 4-(N-Heptyloxy)Phenylboronic Acid
- 4-Heptyloxyphenylboronic Acid
- Akos Brn-0172
- 4-(Heptyloxy)benzeneboronic acid
- oxybenzeneboronic acid
- 4-(N-HEPTYLOXY)BENZENEBORONIC ACID
- 4-n-Heptyloxybenzeneboronic acid(contains varying amounts of Anhydride)
- 4-Heptyloxyphenylboronicaci
- 4-Heptyloxyphenylboronic Acid (contains varying amounts of Anhydride)
- (4-heptoxyphenyl)boronic acid
- Boronic acid, B-[4-(heptyloxy)phenyl]-
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4-Heptyloxyphenylboronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C13H21BO3Color and Shape:White to Almost white powder to crystalMolecular weight:236.124-n-Heptyloxybenzeneboronic acid, 97%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C13H21BO3Purity:97%Molecular weight:236.12Boronic acid, B-[4-(heptyloxy)phenyl]-
CAS:Formula:C13H21BO3Purity:97%Color and Shape:SolidMolecular weight:236.11504-(Heptyloxy)benzeneboronic acid
CAS:<p>4-(Heptyloxy)benzeneboronic acid</p>Purity:≥95%Color and Shape:White SolidMolecular weight:236.12g/mol4-Heptyloxyphenylboronic acid
CAS:Formula:C13H21BO3Purity:98%Color and Shape:SolidMolecular weight:236.12




