CAS 13638-89-6: diethyl (2R,3S)-2,3-diphenylbutanedioate
Description:Diethyl (2R,3S)-2,3-diphenylbutanedioate, with CAS number 13638-89-6, is an organic compound characterized by its ester functional groups and a chiral center, which contributes to its stereochemistry. This compound features two ethyl ester groups attached to a butanedioic acid backbone, specifically at the 2 and 3 positions, each substituted with phenyl groups. The presence of these phenyl groups enhances its hydrophobic character and may influence its solubility in organic solvents. The stereochemistry (2R,3S) indicates that the compound exists in a specific spatial arrangement, which can affect its reactivity and interactions with biological systems. Typically, compounds like this may be used in synthetic organic chemistry, potentially serving as intermediates in the synthesis of more complex molecules or as chiral building blocks. Its properties, such as melting point, boiling point, and reactivity, would depend on the specific conditions and the presence of other functional groups in a reaction environment.
Formula:C20H22O4
InChI:InChI=1/C20H22O4/c1-3-23-19(21)17(15-11-7-5-8-12-15)18(20(22)24-4-2)16-13-9-6-10-14-16/h5-14,17-18H,3-4H2,1-2H3/t17-,18+
- Synonyms:
- Butanedioic acid, 2,3-diphenyl-, diethyl ester, (2R,3S)-
- Diethyl (2R,3S)-2,3-diphenylsuccinate
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 1,4-Diethyl (2S,3R)-2,3-diphenylbutanedioate REF: 54-OR1020923CAS: 13638-89-6 | - - - | 272.00 €~437.00 € | Thu 17 Apr 25 |
![]() | Meso-2,3-Diphenyl-succinic acid diethyl ester REF: 10-F046212CAS: 13638-89-6 | 98.0% | To inquire | Mon 28 Apr 25 |
![]() | Meso-2,3-diphenyl-succinic acid diethyl ester REF: 3D-NAA63889CAS: 13638-89-6 | Min. 95% | - - - | Discontinued product |

Meso-2,3-Diphenyl-succinic acid diethyl ester
Ref: 10-F046212
10g | To inquire | ||
50g | To inquire |

Meso-2,3-diphenyl-succinic acid diethyl ester
Ref: 3D-NAA63889
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
25g | Discontinued | Request information | |
50g | Discontinued | Request information |