CAS 136459-72-8
:Trimethyl[4-(phenylethynyl)phenyl]silane
Description:
Trimethyl[4-(phenylethynyl)phenyl]silane, with the CAS number 136459-72-8, is an organosilicon compound characterized by the presence of a silicon atom bonded to three methyl groups and a phenyl group that is further substituted with a phenylethynyl moiety. This compound exhibits properties typical of silanes, including volatility and reactivity, particularly in the presence of moisture, which can lead to hydrolysis and the formation of silanol groups. The phenylethynyl substituent contributes to its potential applications in organic synthesis and materials science, particularly in the development of functionalized polymers and as a building block in the synthesis of more complex organic molecules. Additionally, the presence of multiple aromatic rings may impart interesting electronic properties, making it a candidate for use in electronic materials or as a ligand in coordination chemistry. Its unique structure allows for various chemical reactions, including cross-coupling reactions, which are valuable in synthetic organic chemistry. Overall, Trimethyl[4-(phenylethynyl)phenyl]silane is a versatile compound with potential applications in various fields of chemistry.
Formula:C17H18Si
InChI:InChI=1/C17H18Si/c1-18(2,3)17-13-11-16(12-14-17)10-9-15-7-5-4-6-8-15/h4-8,11-14H,1-3H3
SMILES:C[Si](C)(C)c1ccc(C#Cc2ccccc2)cc1
Synonyms:- 4-Trimethylsilyl diphenyl acetylene
- 4-(Trimethylsilyl)tolan
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-(Trimethylsilyl)diphenylacetylene, 99%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C17H18SiPurity:99%Color and Shape:Crystals or powder or crystalline powder or fused solid, White to pale creamMolecular weight:250.42TRIMETHYL-[4-(2-PHENYLETHYNYL)PHENYL]SILANE
CAS:Formula:C17H18SiPurity:99%Color and Shape:LiquidMolecular weight:250.41034-(Trimethylsilyl)Diphenylacetylene
CAS:4-(Trimethylsilyl)DiphenylacetylenePurity:99%Molecular weight:250.41g/mol




