
CAS 1364632-66-5
:Hydrazine, [(3,3-difluorocyclobutyl)methyl]-, hydrochloride (1:2)
Description:
Hydrazine, [(3,3-difluorocyclobutyl)methyl]-, hydrochloride (1:2) is a chemical compound characterized by its hydrazine functional group, which is known for its reactivity and use in various applications, including as a reducing agent and in the synthesis of pharmaceuticals. The presence of the 3,3-difluorocyclobutyl moiety introduces unique steric and electronic properties, potentially enhancing its biological activity or stability. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which can facilitate its use in aqueous environments. The compound may exhibit specific characteristics such as a distinct melting point, boiling point, and solubility profile, influenced by its molecular structure and the presence of fluorine atoms. Additionally, safety considerations are paramount, as hydrazine derivatives can be toxic and potentially carcinogenic, necessitating careful handling and storage. Overall, this compound represents a specialized class of hydrazine derivatives with potential applications in medicinal chemistry and materials science.
Formula:C5H10F2N2·2ClH
InChI:InChI=1S/C5H10F2N2.2ClH/c6-5(7)1-4(2-5)3-9-8;;/h4,9H,1-3,8H2;2*1H
InChI key:InChIKey=YMLBEVOIKLJRND-UHFFFAOYSA-N
SMILES:C(NN)C1CC(F)(F)C1.Cl
Synonyms:- Hydrazine, [(3,3-difluorocyclobutyl)methyl]-, hydrochloride (1:2)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.