CAS 136466-94-9
:2,6-Difluoropyridine-3-boronic acid
Description:
2,6-Difluoropyridine-3-boronic acid is an organoboron compound characterized by the presence of both a pyridine ring and a boronic acid functional group. The molecular structure features a pyridine ring substituted with two fluorine atoms at the 2 and 6 positions and a boronic acid group at the 3 position. This compound is typically a white to off-white solid and is soluble in polar solvents such as water and alcohols, which is a characteristic of boronic acids due to their ability to form hydrogen bonds. It is often used in organic synthesis, particularly in Suzuki coupling reactions, where it serves as a key intermediate for the formation of carbon-carbon bonds. The presence of fluorine atoms can enhance the compound's electronic properties and influence its reactivity. Additionally, 2,6-Difluoropyridine-3-boronic acid may exhibit biological activity, making it of interest in medicinal chemistry. Proper handling and storage are essential, as with many boronic acids, to maintain stability and prevent degradation.
Formula:C5H4BF2NO2
InChI:InChI=1/C5H4BF2NO2/c7-4-2-1-3(6(10)11)5(8)9-4/h1-2,10-11H
SMILES:c1cc(F)nc(c1B(O)O)F
Synonyms:- (2,6-Difluoro-3-Pyridinyl)-Boronic Acid
- 2,6-Difluoro-3-Pyridyl Boronic Acid
- (2,6-Difluoropyridin-3-Yl)Boronic Acid
- Boronic acid, (2,6-difluoro-3-pyridinyl)-
- 2,6-Difluoropyridin-3-Ylboronicacid
- 2,6-Difluoro-3-pyridine boronic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Boronic acid, B-(2,6-difluoro-3-pyridinyl)-
CAS:Formula:C5H4BF2NO2Purity:98%Color and Shape:SolidMolecular weight:158.89862,6-Difluoro-3-pyridineboronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C5H4BF2NO2Purity:97.0 to 113.0 %Color and Shape:White to Light yellow powder to crystalMolecular weight:158.902,6-Difluoropyridine-3-boronic acid
CAS:2,6-Difluoropyridine-3-boronic acidFormula:C5H4BF2NO2Purity:96%Color and Shape: off white solidMolecular weight:158.90g/mol2,6-Difluoropyridine-3-boronic acid
CAS:Formula:C5H4BF2NO2Purity:97%Color and Shape:SolidMolecular weight:158.9




