CAS 1364678-10-3

3-Isoxazolemethanamine, 5-(trifluoromethyl)-, hydrochloride (1:1)

Description:

3-Isoxazolemethanamine, 5-(trifluoromethyl)-, hydrochloride (1:1) is a chemical compound characterized by its isoxazole ring structure, which contributes to its unique reactivity and properties. The presence of a trifluoromethyl group enhances its lipophilicity and can influence its biological activity, making it of interest in medicinal chemistry. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, facilitating its use in various applications, including pharmaceuticals. The compound may exhibit specific pharmacological properties, potentially acting as a ligand or inhibitor in biological systems. Its molecular structure suggests potential interactions with biological targets, which could be explored in drug development. Safety and handling precautions should be observed due to the presence of the trifluoromethyl group, which can impart toxicity. Overall, this compound represents a class of substances that may have significant implications in research and therapeutic contexts, warranting further investigation into its properties and applications.

Formula: C₅H₅F₃N₂O·ClH

InChI: InChI=1S/C5H5F3N2O.ClH/c6-5(7,8)4-1-3(2-9)10-11-4;/h1H,2,9H2;1H

InChI key: InChIKey=MPIFDJIRVVSRNB-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C1=CC(CN)=NO1.Cl

Synonyms:

• 3-Isoxazolemethanamine, 5-(trifluoromethyl)-, hydrochloride (1:1)

[5-(Trifluoromethyl)-1,2-oxazol-3-yl]methanamine hydrochloride

CAS: 1364678-10-3

Versatile small molecule scaffold

Formula: C₅H₆ClF₃N₂O

Purity: Min. 95%

Molecular weight: 202.56 g/mol

Ref: 3D-PEC67810