CAS 136470-79-6: (1R,4S)-4-[2-Amino-6-(cyclopropylamino)-9H-purin-9-yl]-2-cyclopentene-1-methanol
Description:The chemical substance known as (1R,4S)-4-[2-Amino-6-(cyclopropylamino)-9H-purin-9-yl]-2-cyclopentene-1-methanol, with the CAS number 136470-79-6, is a complex organic compound characterized by its unique structural features, including a cyclopentene ring and a purine derivative. This compound exhibits chirality, indicated by its (1R,4S) configuration, which can influence its biological activity and interactions. The presence of an amino group and a cyclopropylamino moiety suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Its molecular structure may confer specific properties such as solubility, stability, and reactivity, which are critical for its function in biological systems. Additionally, the compound's interactions with enzymes or receptors could be significant in therapeutic contexts, making it a subject of interest in drug discovery and development. Overall, this substance represents a fascinating example of how structural intricacies can lead to diverse chemical behaviors and potential applications in science and medicine.
Formula:C14H18N6O
InChI:InChI=1S/C14H18N6O/c15-14-18-12(17-9-2-3-9)11-13(19-14)20(7-16-11)10-4-1-8(5-10)6-21/h1,4,7-10,21H,2-3,5-6H2,(H3,15,17,18,19)/t8-,10+/m0/s1
InChI key:InChIKey=MCGSCOLBFJQGHM-WCBMZHEXSA-N
SMILES:OCC1C=CC(N2C=NC=3C(=NC(=NC32)N)NC4CC4)C1
- Synonyms:
- (1R,4S)-4-[2-Amino-6-(cyclopropylamino)-9H-purin-9-yl]-2-cyclopentene-1-methanol
- 2-Cyclopentene-1-methanol, 4-[2-amino-6-(cyclopropylamino)-9H-purin-9-yl]-, (1R,4S)-
- 2-Cyclopentene-1-methanol, 4-[2-amino-6-(cyclopropylamino)-9H-purin-9-yl]-, (1R-cis)-
![(1R,4S)-4-[2-Amino-6-(cyclopropylamino)-9H-purin-9-yl]-2-cyclopentene-1-methanol](https://static.cymitquimica.com/cas-image/415924-1r-4s-4-2-amino-6-cyclopropylamino-9h-purin-9-yl-2-cyclopentene-1-methanol.png)
![2-Cyclopentene-1-methanol, 4-[2-amino-6-(cyclopropylamino)-9H-purin-9-yl]-, (1R,4S)-](https://static.cymitquimica.com/products/IN/thumb/DA0011WB.jpg)
