CAS 1364917-16-7
:2,3,6-Trimethoxy-4-pyridinecarboxaldehyde
Description:
2,3,6-Trimethoxy-4-pyridinecarboxaldehyde is an organic compound characterized by its pyridine ring, which is substituted with three methoxy groups and an aldehyde functional group. The presence of the methoxy groups enhances its solubility in organic solvents and may influence its reactivity and biological activity. This compound typically exhibits a pale yellow to light brown appearance and has a distinctive aromatic odor due to the aldehyde group. It is often utilized in organic synthesis and may serve as an intermediate in the production of various pharmaceuticals and agrochemicals. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of compounds with antimicrobial or anti-inflammatory properties. Additionally, its unique electronic properties, derived from the electron-donating methoxy groups, may contribute to its reactivity in electrophilic aromatic substitution reactions. As with many organic compounds, handling should be done with care, considering potential toxicity and environmental impact.
Formula:C9H11NO4
InChI:InChI=1S/C9H11NO4/c1-12-7-4-6(5-11)8(13-2)9(10-7)14-3/h4-5H,1-3H3
InChI key:InChIKey=QFGPUXBJJHMZCX-UHFFFAOYSA-N
SMILES:O(C)C=1C(C=O)=CC(OC)=NC1OC
Synonyms:- 2,3,6-Trimethoxyisonicotinaldehyde
- 2,3,6-Trimethoxypyridine-4-carbaldehyde
- 4-Pyridinecarboxaldehyde, 2,3,6-trimethoxy-
- 2,3,6-Trimethoxy-4-pyridinecarboxaldehyde
- 2,3,6-trimethoxypyridine-4-carboxaldehyde
- 4-Ethenyl-2,3,6-trimethoxypyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.