CymitQuimica logo

CAS 136496-72-5

:

4-CARBOXY-3-CHLOROPHENYLBORONIC ACID

Description:
4-Carboxy-3-chlorophenylboronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols, making it useful in various chemical applications, including drug development and materials science. This compound features a chlorophenyl group, which contributes to its reactivity and potential biological activity. The carboxylic acid group enhances its solubility in polar solvents and can participate in hydrogen bonding, influencing its interactions in biological systems. The presence of the chlorine atom can also affect the electronic properties of the molecule, potentially enhancing its reactivity in cross-coupling reactions, such as Suzuki coupling. Overall, 4-carboxy-3-chlorophenylboronic acid is a versatile compound with applications in organic synthesis, medicinal chemistry, and as a building block in the development of complex molecular structures. Its unique functional groups allow for diverse reactivity, making it a valuable compound in both research and industrial settings.
Formula:C7H6BClO4
InChI:InChI=1/C7H6BClO4/c9-6-3-4(8(12)13)1-2-5(6)7(10)11/h1-3,12-13H,(H,10,11)
InChI key:QFAFGWXQNDYXPZ-UHFFFAOYSA-N
SMILES:c1cc(c(cc1B(O)O)Cl)C(=O)O
Synonyms:
  • Akos Brn-0544
  • 3-Chloro-4-Carboxyphenylboronic Acid
  • (4-Carboxy-3-Chloro)Benzeneboronic Acid
  • 4-Borono-2-Chlorobenzoic Acid
  • 4-Carboxy-3-chlorobenzeneboronic acid 98%
  • 5-Carboxy-3-chlorophenyl boronic acid
  • 2-Chloro-4-(Dihydroxyboranyl)Benzoic Acid
Found 6 products.