CAS 13650-49-2
:N D-T-boc-L-ornithine
Description:
N D-T-boc-L-ornithine, with the CAS number 13650-49-2, is a derivative of the amino acid ornithine, which plays a crucial role in the urea cycle and is involved in various metabolic processes. This compound features a tert-butyloxycarbonyl (Boc) protecting group, which is commonly used in peptide synthesis to protect the amino group of the amino acid, thereby preventing unwanted reactions during the synthesis process. N D-T-boc-L-ornithine is typically a white to off-white crystalline solid, and it is soluble in organic solvents such as dimethyl sulfoxide (DMSO) and methanol, but less soluble in water. The presence of the Boc group enhances the stability of the amino acid during chemical reactions, making it a valuable intermediate in the synthesis of peptides and other bioactive compounds. Additionally, this compound is often utilized in research and pharmaceutical applications, particularly in the development of peptide-based drugs and in studies related to protein synthesis and modification.
Formula:C10H20N2O4
InChI:InChI=1/C10H20N2O4/c1-10(2,3)16-9(15)12-6-4-5-7(11)8(13)14/h7H,4-6,11H2,1-3H3,(H,12,15)(H,13,14)
SMILES:CC(C)(C)OC(=NCCCC(C(=O)O)N)O
Synonyms:- H-Orn(Boc)-OH
- N~5~-(tert-butoxycarbonyl)ornithine
- Boc-L-Orn-Oh
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Nδ-Boc-L-ornithine, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C10H20N2O4Purity:98%Molecular weight:232.28H-Orn(Boc)-OH
CAS:Bachem ID: 4004448.
Formula:C10H20N2O4Purity:> 99%Color and Shape:WhiteMolecular weight:232.28L-Ornithine, N5-[(1,1-dimethylethoxy)carbonyl]-
CAS:Formula:C10H20N2O4Purity:97%Color and Shape:SolidMolecular weight:232.2768




