CAS 13650-70-9
:1,1-Dimethylethyl (2S)-2-hydroxypropanoate
Description:
1,1-Dimethylethyl (2S)-2-hydroxypropanoate, also known as tert-butyl lactate, is an organic compound characterized by its ester functional group. It features a tert-butyl group, which contributes to its hydrophobic nature, and a hydroxypropanoate moiety that imparts some polarity. This compound is typically a colorless liquid with a mild, pleasant odor, making it suitable for use in various applications, including as a solvent and in the formulation of personal care products. It is known for its relatively low toxicity and biodegradability, which makes it an environmentally friendly alternative to traditional solvents. The compound exhibits moderate solubility in water and is more soluble in organic solvents. Its chemical structure allows for potential applications in organic synthesis and as an intermediate in the production of other chemicals. Additionally, it may participate in various chemical reactions, including esterification and hydrolysis, under appropriate conditions. Overall, 1,1-Dimethylethyl (2S)-2-hydroxypropanoate is valued for its functional properties and versatility in chemical processes.
Formula:C7H14O3
InChI:InChI=1S/C7H14O3/c1-5(8)6(9)10-7(2,3)4/h5,8H,1-4H3/t5-/m0/s1
InChI key:InChIKey=IXXMVXXFAJGOQO-YFKPBYRVSA-N
SMILES:C(OC(C)(C)C)([C@H](C)O)=O
Synonyms:- 1,1-Dimethylethyl (2S)-2-hydroxypropanoate
- <span class="text-smallcaps">L</span>-Lactic acid tert-butyl ester
- L-Lactic acid tert-butyl ester
- Lactic acid, tert-butyl ester, <span class="text-smallcaps">L</span>-
- Propanoic acid, 2-hydroxy-, 1,1-dimethylethyl ester, (2S)-
- Propanoic acid, 2-hydroxy-, 1,1-dimethylethyl ester, (S)-
- tert-Butyl (S)-(-)-lactate
- tert-Butyl (S)-2-hydroxypropanoate
- tert-Butyl <span class="text-smallcaps">L</span>-lactate
- tert-butyl (2S)-2-hydroxypropanoate
- Lactic acid, tert-butyl ester, L-
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Ref: IN-DA009CEZ
1g111.00€5g192.00€10g322.00€1kgTo inquire25gTo inquire250gTo inquire500gTo inquire100mg50.00€250mg53.00€Tert-butyl(S)-lactate
CAS:Tert-butyl(S)-lactate is a reaction component that is used to synthesize other organic compounds. It can be used in the synthesis of pharmaceuticals, agrochemicals, and other chemicals. Tert-butyl(S)-lactate is a versatile building block with many applications. It can be used as an intermediate for complex compounds or as a reagent for high quality research chemicals. Tert-Butyl(S)-lactate is also a speciality chemical that can be used to synthesize fine chemicals.Formula:C7H14O3Purity:Min. 95%Color and Shape:PowderMolecular weight:146.18 g/mol



