CAS 13650-75-4
:Boc-Pro-Leu-Val-OMe
Description:
Boc-Pro-Leu-Val-OMe, also known as a protected peptide, is a synthetic compound commonly used in peptide chemistry and drug development. The "Boc" (tert-butyloxycarbonyl) group serves as a protective group for the amino group of proline (Pro), while "Leu" (leucine) and "Val" (valine) are amino acids that contribute to the peptide's structure. The "OMe" (methoxy) indicates the presence of a methoxy group, typically attached to the carboxylic acid of valine, enhancing the compound's solubility and stability. This compound is characterized by its relatively high molecular weight and specific stereochemistry, which can influence its biological activity and interactions. It is often utilized in the synthesis of more complex peptides and can serve as a building block in the development of pharmaceuticals. The presence of protective groups allows for selective reactions during synthesis, making it a valuable intermediate in organic and medicinal chemistry. As with many peptides, its properties can be influenced by factors such as pH, temperature, and solvent conditions.
Formula:C22H39N3O6
InChI:InChI=1/C22H39N3O6/c1-13(2)12-15(18(26)24-17(14(3)4)20(28)30-8)23-19(27)16-10-9-11-25(16)21(29)31-22(5,6)7/h13-17H,9-12H2,1-8H3,(H,23,27)(H,24,26)
SMILES:CC(C)CC(C(=NC(C(C)C)C(=O)OC)O)N=C(C1CCCN1C(=O)OC(C)(C)C)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
L-Valine, 1-[(1,1-dimethylethoxy)carbonyl]-L-prolyl-L-leucyl-, methyl ester
CAS:Formula:C22H39N3O6Molecular weight:441.5616Boc-Pro-Leu-Val-OMe
CAS:<p>Boc-Pro-Leu-Val-OMe is a peptide analog of Dolastatin 10 which has been shown to inhibit the production of ATP in mitochondria. The compound binds to the active site of bacterial topoisomerase IV, and this binding prevents the enzyme from cleaving DNA. Boc-Pro-Leu-Val-OMe is a small molecule that has an intramolecular structure, and it interacts with DNA to form a stable complex.</p>Formula:C22H39N3O6Purity:Min. 95%Molecular weight:441.56 g/mol

