CAS 136522-35-5
:(1S,4R)-4-Amino-2-cyclopentene-1-methanol
Description:
(1S,4R)-4-Amino-2-cyclopentene-1-methanol is a chiral organic compound characterized by its unique cyclopentene structure, which includes an amino group and a hydroxymethyl group. The presence of the amino group contributes to its potential as a building block in pharmaceutical synthesis, while the hydroxymethyl group can participate in various chemical reactions, such as nucleophilic substitutions. The specific stereochemistry indicated by the (1S,4R) configuration suggests that the compound exhibits optical activity, making it relevant in the study of enantiomers and their biological activities. This compound may also display interesting reactivity due to the strained cyclopentene ring, which can influence its stability and reactivity patterns. Its applications could extend to medicinal chemistry, where such compounds are often explored for their potential therapeutic effects. Overall, (1S,4R)-4-Amino-2-cyclopentene-1-methanol represents a valuable structure in organic synthesis and medicinal research, with its properties largely dictated by its functional groups and stereochemistry.
Formula:C6H11NO
InChI:InChI=1S/C6H11NO/c7-6-2-1-5(3-6)4-8/h1-2,5-6,8H,3-4,7H2/t5-,6+/m1/s1
InChI key:InChIKey=UXKZFJDNFBNQHE-RITPCOANSA-N
SMILES:C(O)[C@H]1C[C@@H](N)C=C1
Synonyms:- (1S,4R)-4-Amino-2-Cyclopentene-1-Methanol
- (1s,Cis)-4-amino-2-cyclopentene-1-methanol
- 2-Cyclopentene-1-methanol, 4-amino-, (1S,4R)-
- 2-Cyclopentene-1-methanol, 4-amino-, (1S-cis)-
- Aminocarbinol
- [(1S,4R)-4-aminocyclopent-2-en-1-yl]methanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
(1S,4R)-4-Amino-2-cyclopentene-1-methanol (-)-Dibenzoyl-L-tartaric Acid
CAS:Controlled ProductApplications (1S,4R)-4-Amino-2-cyclopentene-1-methanol (-)-Dibenzoyl-L-tartaric Acid is an intermediate in synthesizing ent-Abacavir (Abacavir EP Impurity A) (A105015), an enatiomer of Abacavir (A105000). Abacavir is a carbocyclic 2'-deoxyguanosine nucleoside reverse transcriptase inhibitor and an anti-HIV drug used to treat HIV infection (1). Intracellular enzymes convert Abacavir to its active form, carbovir-triphosphate (CBV-TP), which then selectively inhibits HIV reverse transcriptase by incorporating into viral DNA (2). Abacavir is metabolized in the liver by uridine diphosphate glucuronyltransferase and alcohol dehydrogenase resulting in inactive glucuronide and carboxylate metabolites, respectively.
Formula:C6H11NO·C18H14O8Color and Shape:NeatMolecular weight:471.46(1S,4R)-4-Amino-2-cyclopentene-1-methanol
CAS:Controlled ProductFormula:C6H11NOColor and Shape:NeatMolecular weight:113.158

