CymitQuimica logo

CAS 1365267-27-1

:

X-396

Description:
As of my last update in October 2023, there is no widely recognized chemical substance known as "X-396" with the CAS number "1365267-27-1." It is possible that this compound is either a newly developed substance, a proprietary compound, or one that has not yet gained significant attention in the scientific literature. Typically, chemical substances are characterized by their molecular structure, physical properties (such as melting point, boiling point, and solubility), chemical reactivity, and potential applications in various fields, including pharmaceuticals, materials science, or industrial processes. To obtain accurate and detailed information about a specific compound, including its characteristics, it is advisable to consult scientific databases, peer-reviewed journals, or material safety data sheets (MSDS) that may provide insights into its properties and uses. If "X-396" is a recent development, checking the latest research publications or patent filings may also yield relevant information.
Formula:C25H25Cl2FN6O3
InChI:InChI=1S/C25H25Cl2FN6O3/c1-14(21-17(26)7-8-18(28)22(21)27)37-20-13-19(31-32-23(20)29)24(35)30-16-5-3-15(4-6-16)25(36)34-11-9-33(2)10-12-34/h3-8,13-14H,9-12H2,1-2H3,(H2,29,32)(H,30,35)/t14-/m1/s1
InChI key:ONPGOSVDVDPBCY-CQSZACIVSA-N
SMILES:C[C@H](C1=C(C=CC(=C1Cl)F)Cl)OC2=CC(=NN=C2N)C(=O)NC3=CC=C(C=C3)C(=O)N4CCN(CC4)C
Found 4 products.