CAS 1365267-37-3: 2-[[[[(5S)-2-Oxo-3-[4-(3-oxo-4-morpholinyl)phenyl]-5-oxazolidinyl]methyl]amino]carbonyl]benzoic acid
Description:The chemical substance known as 2-[[[[(5S)-2-Oxo-3-[4-(3-oxo-4-morpholinyl)phenyl]-5-oxazolidinyl]methyl]amino]carbonyl]benzoic acid, with the CAS number 1365267-37-3, is characterized by its complex molecular structure, which includes an oxazolidine ring, a benzoic acid moiety, and a morpholine derivative. This compound is likely to exhibit properties typical of both amides and carboxylic acids, including potential solubility in polar solvents and the ability to form hydrogen bonds due to the presence of functional groups such as the carboxylic acid and amine. The oxazolidine ring suggests potential biological activity, possibly as an antibiotic or in other therapeutic applications, as oxazolidinones are known for their role in medicinal chemistry. Additionally, the presence of multiple functional groups indicates that this compound may participate in various chemical reactions, making it a candidate for further research in drug development or synthetic chemistry. Its stereochemistry, particularly the (5S) configuration, may also influence its biological activity and interaction with biological targets.
Formula:C22H21N3O7
InChI:InChI=1S/C22H21N3O7/c26-19-13-31-10-9-24(19)14-5-7-15(8-6-14)25-12-16(32-22(25)30)11-23-20(27)17-3-1-2-4-18(17)21(28)29/h1-8,16H,9-13H2,(H,23,27)(H,28,29)/t16-/m0/s1
InChI key:InChIKey=OXEFOWVRNIRGLF-INIZCTEOSA-N
SMILES:O=C(O)C=1C=CC=CC1C(=O)NCC2OC(=O)N(C3=CC=C(C=C3)N4C(=O)COCC4)C2
- Synonyms:
- (S)-2-(((2-Oxo-3-(4-(3-oxomorpholino)phenyl)oxazolidin-5-yl)methyl)carbamoyl)benzoic acid
- 2-[[[[(5S)-2-Oxo-3-[4-(3-oxo-4-morpholinyl)phenyl]-5-oxazolidinyl]methyl]amino]carbonyl]benzoic acid
- Benzoic acid, 2-[[[[(5S)-2-oxo-3-[4-(3-oxo-4-morpholinyl)phenyl]-5-oxazolidinyl]methyl]amino]carbonyl]-