CAS 1365271-77-7
:3′-Cyano-N,N-dimethyl[1,1′-biphenyl]-4-carboxamide
Description:
3′-Cyano-N,N-dimethyl[1,1′-biphenyl]-4-carboxamide is a chemical compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a cyano group (-CN) at the 3′ position and a carboxamide group (-C(=O)N(CH3)2) at the 4 position contributes to its chemical reactivity and potential applications. This compound is likely to exhibit polar characteristics due to the functional groups, influencing its solubility in various solvents. The dimethyl substitution on the nitrogen atom of the carboxamide enhances its steric bulk, which may affect its interaction with biological targets or other chemical species. Additionally, the cyano group can participate in various chemical reactions, making this compound of interest in synthetic organic chemistry and potentially in pharmaceutical applications. Its specific properties, such as melting point, boiling point, and reactivity, would require empirical measurement or detailed computational analysis for precise characterization.
Formula:C16H14N2O
InChI:InChI=1S/C16H14N2O/c1-18(2)16(19)14-8-6-13(7-9-14)15-5-3-4-12(10-15)11-17/h3-10H,1-2H3
InChI key:InChIKey=OUTXBBZIDLYPCY-UHFFFAOYSA-N
SMILES:C(#N)C=1C=C(C2=CC=C(C(N(C)C)=O)C=C2)C=CC1
Synonyms:- 3′-Cyano-N,N-dimethyl[1,1′-biphenyl]-4-carboxamide
- [1,1′-Biphenyl]-4-carboxamide, 3′-cyano-N,N-dimethyl-
- 4-(3-Cyanophenyl)-N,N-diMethylbenzaMide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
