CAS 1365271-84-6
:4-Bromo-N-cyclohexyl-2-nitro-5-propoxybenzenamine
Description:
4-Bromo-N-cyclohexyl-2-nitro-5-propoxybenzenamine is an organic compound characterized by its complex structure, which includes a bromine atom, a nitro group, and a propoxy substituent on a benzene ring. The presence of the cyclohexyl group contributes to its hydrophobic characteristics, while the nitro group introduces polarity, affecting its solubility and reactivity. This compound is likely to exhibit moderate to low solubility in water due to the bulky cyclohexyl and propoxy groups, but it may dissolve in organic solvents. The bromine atom can participate in electrophilic substitution reactions, while the amino group can act as a nucleophile. The compound's nitro group may also influence its electronic properties, potentially making it a candidate for various chemical reactions, including reduction or substitution. Overall, the unique combination of functional groups in 4-Bromo-N-cyclohexyl-2-nitro-5-propoxybenzenamine suggests potential applications in pharmaceuticals or materials science, although specific applications would depend on further research and characterization.
Formula:C15H21BrN2O3
InChI:InChI=1S/C15H21BrN2O3/c1-2-8-21-15-10-13(14(18(19)20)9-12(15)16)17-11-6-4-3-5-7-11/h9-11,17H,2-8H2,1H3
InChI key:InChIKey=LRCWFJHWOTYXMB-UHFFFAOYSA-N
SMILES:N(C1=C(N(=O)=O)C=C(Br)C(OCCC)=C1)C2CCCCC2
Synonyms:- Benzenamine, 4-bromo-N-cyclohexyl-2-nitro-5-propoxy-
- 4-Bromo-N-cyclohexyl-2-nitro-5-propoxybenzenamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
