CAS 1365272-14-5

1,1-Dimethylethyl N-(8-bromo-5-quinolinyl)carbamate

Description:

1,1-Dimethylethyl N-(8-bromo-5-quinolinyl)carbamate, identified by its CAS number 1365272-14-5, is a chemical compound that features a carbamate functional group, which is characterized by the presence of a carbonyl group (C=O) bonded to a nitrogen atom (N) that is also connected to an alkyl or aryl group. This compound includes a dimethyl substituent, indicating the presence of two methyl groups attached to a tertiary carbon, which contributes to its steric bulk. The presence of the 8-bromo-5-quinolinyl moiety suggests that it has potential biological activity, as quinoline derivatives are often studied for their pharmacological properties. The bromine atom may enhance the compound's reactivity and influence its interaction with biological targets. Overall, this compound's unique structure may confer specific chemical properties, such as solubility, stability, and reactivity, making it of interest in medicinal chemistry and drug development. Further studies would be necessary to fully elucidate its characteristics and potential applications.

Formula: C₁₄H₁₅BrN₂O₂

InChI: InChI=1S/C14H15BrN2O2/c1-14(2,3)19-13(18)17-11-7-6-10(15)12-9(11)5-4-8-16-12/h4-8H,1-3H3,(H,17,18)

InChI key: InChIKey=BEJYTIZMSSGRBZ-UHFFFAOYSA-N

SMILES: N(C(OC(C)(C)C)=O)C=1C2=C(C(Br)=CC1)N=CC=C2

Synonyms:

• 1,1-Dimethylethyl N-(8-bromo-5-quinolinyl)carbamate
• Carbamic acid, N-(8-bromo-5-quinolinyl)-, 1,1-dimethylethyl ester

5-(N-BOC-Amino)-8-bromoquinoline

CAS: 1365272-14-5

Formula: C₁₄H₁₅BrN₂O₂

Molecular weight: 323.1851

Ref: IN-DA0011ZK