![Methyl 3-fluoro-3′-nitro[1,1′-biphenyl]-4-carboxylate](https://static.cymitquimica.com/cas-image/356737-methyl-3-fluoro-3-nitro-11-biphenyl-4-carboxylate.png)
CAS 1365272-60-1: Methyl 3-fluoro-3′-nitro[1,1′-biphenyl]-4-carboxylate
Description:Methyl 3-fluoro-3′-nitro[1,1′-biphenyl]-4-carboxylate is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a nitro group (-NO2) and a fluoro group (-F) on the biphenyl framework contributes to its chemical reactivity and polarity. The carboxylate functional group (-COOCH3) indicates that it is an ester, specifically a methyl ester, which can influence its solubility and reactivity in various chemical environments. This compound may exhibit interesting properties such as potential biological activity, making it of interest in pharmaceutical and agrochemical research. Its molecular structure suggests that it could participate in electrophilic aromatic substitution reactions due to the electron-withdrawing nature of the nitro and fluoro substituents. Additionally, the compound's stability and reactivity can be influenced by factors such as temperature, solvent, and the presence of other reagents. Overall, Methyl 3-fluoro-3′-nitro[1,1′-biphenyl]-4-carboxylate is a versatile compound with potential applications in various fields of chemistry.
Formula:C14H10FNO4
InChI:InChI=1S/C14H10FNO4/c1-20-14(17)12-6-5-10(8-13(12)15)9-3-2-4-11(7-9)16(18)19/h2-8H,1H3
InChI key:InChIKey=ZSFNELXOSKFDSK-UHFFFAOYSA-N
SMILES:O=C(OC)C1=CC=C(C=C1F)C=2C=CC=C(C2)N(=O)=O
- Synonyms:
- [1,1′-Biphenyl]-4-carboxylic acid, 3-fluoro-3′-nitro-, methyl ester
- Methyl 3-fluoro-3′-nitro[1,1′-biphenyl]-4-carboxylate
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | [1,1'-Biphenyl]-4-carboxylic acid, 3-fluoro-3'-nitro-, methyl ester REF: IN-DA00121ACAS: 1365272-60-1 | - - - | To inquire | Tue 11 Mar 25 |
 | Methyl 2-fluoro-4-(3-nitrophenyl)benzoate REF: 10-F638856CAS: 1365272-60-1 | 98% | - - - | Discontinued product |
 | Methyl 2-fluoro-4-(3-nitrophenyl)benzoate REF: 3D-QEC27260CAS: 1365272-60-1 | Min. 95% | - - - | Discontinued product |
![[1,1'-Biphenyl]-4-carboxylic acid, 3-fluoro-3'-nitro-, methyl ester](https://static.cymitquimica.com/products/IN/thumb/DA00121A.jpg)
[1,1'-Biphenyl]-4-carboxylic acid, 3-fluoro-3'-nitro-, methyl ester
Ref: IN-DA00121A
| Undefined size | To inquire |
Methyl 2-fluoro-4-(3-nitrophenyl)benzoate
Ref: 10-F638856
| 1g | Discontinued | Request information | |
| 5g | Discontinued | Request information |
Methyl 2-fluoro-4-(3-nitrophenyl)benzoate
Ref: 3D-QEC27260
| 1g | Discontinued | Request information | |
| 5g | Discontinued | Request information | |
| 10g | Discontinued | Request information | |
| 250mg | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
