CAS 1365272-60-1

Methyl 3-fluoro-3′-nitro[1,1′-biphenyl]-4-carboxylate

Description:

Methyl 3-fluoro-3′-nitro[1,1′-biphenyl]-4-carboxylate is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a nitro group (-NO2) and a fluoro group (-F) on the biphenyl framework contributes to its chemical reactivity and polarity. The carboxylate functional group (-COOCH3) indicates that it is an ester, specifically a methyl ester, which can influence its solubility and reactivity in various chemical environments. This compound may exhibit interesting properties such as potential biological activity, making it of interest in pharmaceutical and agrochemical research. Its molecular structure suggests that it could participate in electrophilic aromatic substitution reactions due to the electron-withdrawing nature of the nitro and fluoro substituents. Additionally, the compound's stability and reactivity can be influenced by factors such as temperature, solvent, and the presence of other reagents. Overall, Methyl 3-fluoro-3′-nitro[1,1′-biphenyl]-4-carboxylate is a versatile compound with potential applications in various fields of chemistry.

Formula: C₁₄H₁₀FNO₄

InChI: InChI=1S/C14H10FNO4/c1-20-14(17)12-6-5-10(8-13(12)15)9-3-2-4-11(7-9)16(18)19/h2-8H,1H3

InChI key: InChIKey=ZSFNELXOSKFDSK-UHFFFAOYSA-N

SMILES: FC=1C=C(C=CC1C(OC)=O)C2=CC(N(=O)=O)=CC=C2

Synonyms:

• [1,1′-Biphenyl]-4-carboxylic acid, 3-fluoro-3′-nitro-, methyl ester
• Methyl 3-fluoro-3′-nitro[1,1′-biphenyl]-4-carboxylate
• Methyl 2-fluoro-4-(3-nitrophenyl)benzoate

Methyl 2-fluoro-4-(3-nitrophenyl)benzoate

CAS: 1365272-60-1

Formula: C₁₄H₁₀FNO₄

Molecular weight: 275.2319

Ref: IN-DA00121A