CAS 1365272-63-4
:2-Bromo-6-(2-methylpropoxy)benzonitrile
Description:
2-Bromo-6-(2-methylpropoxy)benzonitrile is an organic compound characterized by its aromatic structure, which includes a bromine atom and a benzonitrile functional group. The presence of the bromine atom at the 2-position of the benzene ring contributes to its reactivity, making it a potential candidate for various chemical reactions, such as nucleophilic substitutions. The 6-position features a 2-methylpropoxy group, which enhances the compound's lipophilicity and may influence its solubility in organic solvents. This compound is typically used in synthetic organic chemistry and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its molecular structure suggests it may exhibit specific biological activities, although detailed studies would be required to ascertain its pharmacological properties. Safety data should be consulted before handling, as halogenated compounds can pose health risks. Overall, 2-Bromo-6-(2-methylpropoxy)benzonitrile is a versatile compound with potential applications in various chemical syntheses.
Formula:C11H12BrNO
InChI:InChI=1S/C11H12BrNO/c1-8(2)7-14-11-5-3-4-10(12)9(11)6-13/h3-5,8H,7H2,1-2H3
InChI key:InChIKey=ZUKLSCYYESFDIA-UHFFFAOYSA-N
SMILES:O(CC(C)C)C1=C(C#N)C(Br)=CC=C1
Synonyms:- 2-Bromo-6-(2-methylpropoxy)benzonitrile
- Benzonitrile, 2-bromo-6-(2-methylpropoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.