CAS 1365272-64-5
:4-Bromo-N1-cyclopentyl-5-fluoro-1,2-benzenediamine
Description:
4-Bromo-N1-cyclopentyl-5-fluoro-1,2-benzenediamine is a chemical compound characterized by its specific molecular structure, which includes a bromine atom and a fluorine atom attached to a benzene ring, along with a cyclopentyl group and two amine functional groups. This compound is typically classified as an aromatic amine due to the presence of the benzene ring and the amine groups. Its molecular formula reflects the presence of multiple elements, including carbon, hydrogen, bromine, and fluorine. The compound may exhibit properties such as moderate solubility in organic solvents and potential reactivity due to the functional groups present. It is important to note that compounds like this can have applications in pharmaceuticals, agrochemicals, or materials science, depending on their specific properties and biological activity. Safety data should be consulted for handling and potential hazards, as aromatic amines can sometimes be associated with toxicity or environmental concerns.
Formula:C11H14BrFN2
InChI:InChI=1S/C11H14BrFN2/c12-8-5-10(14)11(6-9(8)13)15-7-3-1-2-4-7/h5-7,15H,1-4,14H2
InChI key:InChIKey=YTSAEWCCFSDLQP-UHFFFAOYSA-N
SMILES:N(C1=C(N)C=C(Br)C(F)=C1)C2CCCC2
Synonyms:- 1,2-Benzenediamine, 4-bromo-N1-cyclopentyl-5-fluoro-
- 4-Bromo-N1-cyclopentyl-5-fluoro-1,2-benzenediamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
