CAS 136552-06-2
:(S)-N-Fmoc-Azetidine-2-carboxylic acid
Description:
(S)-N-Fmoc-Azetidine-2-carboxylic acid is a chiral amino acid derivative characterized by its azetidine ring structure, which contributes to its unique properties. The Fmoc (9-fluorenylmethoxycarbonyl) group serves as a protective group for the amine, facilitating its use in peptide synthesis by preventing premature reactions. This compound is typically utilized in the field of organic chemistry and peptide synthesis due to its ability to introduce structural diversity into peptides. The presence of the carboxylic acid functional group allows for further derivatization and conjugation reactions. Its chirality, indicated by the (S) configuration, is crucial for biological activity, as it can influence the interaction with biological targets. The compound is generally stable under standard laboratory conditions but should be handled with care to avoid degradation. Its solubility in organic solvents makes it suitable for various synthetic applications, particularly in the development of pharmaceuticals and biologically active compounds.
Formula:C19H16NO4
InChI:InChI=1/C19H17NO4/c21-18(22)17-9-10-20(17)19(23)24-11-16-14-7-3-1-5-12(14)13-6-2-4-8-15(13)16/h1-8,16-17H,9-11H2,(H,21,22)/p-1/t17-/m0/s1
SMILES:c1ccc2c(c1)c1ccccc1C2COC(=O)N1CC[C@H]1C(=O)[O-]
Synonyms:- (S)-N-(9-Fluorenylmethoxycarbonyl)-azetidine-2-carboxylic acid
- (2S)-1-[(9H-fluoren-9-ylmethoxy)carbonyl]azetidine-2-carboxylic acid
- (2S)-1-[(9H-fluoren-9-ylmethoxy)carbonyl]azetidine-2-carboxylate
- 1-Fmoc-(S)-azetidine-2-carboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Fmoc-L-azetidine-2-carboxylic acid
CAS:A suitable derivative for incorporating this strained proline analog in peptides to modify their conformation. Its influence on the stability of the collagen helix has been studied by Zagari et al. Fmoc-Aze-OH was employed in the solid-phase synthesis of potent cyclic GnRH analogs.Formula:C19H17NO4Purity:99.9%Color and Shape:WhiteMolecular weight:323.35(S)-1-(((9H-Fluoren-9-yl)methoxy)carbonyl)azetidine-2-carboxylic acid
CAS:Formula:C19H17NO4Purity:97%Color and Shape:SolidMolecular weight:323.34261-Fmoc-(S)-azetidine-2-carboxylic acid
CAS:1-Fmoc-(S)-azetidine-2-carboxylic acidPurity:96%Molecular weight:323.34g/mol(S)-1-(((9H-Fluoren-9-yl)methoxy)carbonyl)azetidine-2-carboxylic acid
CAS:Formula:C19H17NO4Purity:98%Color and Shape:SolidMolecular weight:323.348




