CAS 1365531-99-2: 1,1′-[(1S)-4,4′,6,6′-Tetramethoxy[1,1′-biphenyl]-2,2′-diyl]bis[1,1-bis[3,5-bis(1,1-dimethylethyl)-4-methoxyphenyl]phosphine
Description:The chemical substance known as 1,1′-[(1S)-4,4′,6,6′-Tetramethoxy[1,1′-biphenyl]-2,2′-diyl]bis[1,1-bis[3,5-bis(1,1-dimethylethyl)-4-methoxyphenyl]phosphine] is a complex organophosphorus compound characterized by its intricate molecular structure, which includes multiple methoxy groups and bulky tert-butyl substituents. This compound features a biphenyl backbone, contributing to its potential applications in organic synthesis and catalysis. The presence of phosphine groups indicates that it may exhibit properties relevant to coordination chemistry, potentially acting as a ligand in metal complexes. Its sterically hindered structure may influence its reactivity and stability, making it suitable for specific catalytic processes. Additionally, the methoxy groups can enhance solubility in organic solvents and may influence electronic properties, which could be beneficial in various chemical applications. Overall, this compound exemplifies the intersection of organic and inorganic chemistry, showcasing the versatility of phosphine derivatives in synthetic methodologies.
Formula:C76H108O8P2
InChI:InChI=1S/C76H108O8P2/c1-69(2,3)51-37-47(38-52(65(51)81-29)70(4,5)6)85(48-39-53(71(7,8)9)66(82-30)54(40-48)72(10,11)12)61-35-45(77-25)33-59(79-27)63(61)64-60(80-28)34-46(78-26)36-62(64)86(49-41-55(73(13,14)15)67(83-31)56(42-49)74(16,17)18)50-43-57(75(19,20)21)68(84-32)58(44-50)76(22,23)24/h33-44H,1-32H3
InChI key:InChIKey=KACYLFSRRUJDSY-UHFFFAOYSA-N
SMILES:O(C1=CC(OC)=C(C(=C1)P(C=2C=C(C(OC)=C(C2)C(C)(C)C)C(C)(C)C)C=3C=C(C(OC)=C(C3)C(C)(C)C)C(C)(C)C)C4=C(OC)C=C(OC)C=C4P(C=5C=C(C(OC)=C(C5)C(C)(C)C)C(C)(C)C)C=6C=C(C(OC)=C(C6)C(C)(C)C)C(C)(C)C)C
- Synonyms:
- Phosphine, 1,1′-[(1S)-4,4′,6,6′-tetramethoxy[1,1′-biphenyl]-2,2′-diyl]bis[1,1-bis[3,5-bis(1,1-dimethylethyl)-4-methoxyphenyl]-
- 1,1′-[(1S)-4,4′,6,6′-Tetramethoxy[1,1′-biphenyl]-2,2′-diyl]bis[1,1-bis[3,5-bis(1,1-dimethylethyl)-4-methoxyphenyl]phosphine

(S)-2,2'-Bis[bis(3,5-di-tert-butyl-4-methoxyphenyl)phosphino]-4,4',6,6'-tetramethoxybiphenyl, 97+%
Ref: 02-H60315
1g | To inquire | ||
250mg | To inquire |

(S)-2,2'-Bis[bis(4-methoxy-3,5-di-t-butylphenyl)phosphino]-4,4',6,6'-tetramethoxy)-1,1'-biphenyl, min. 97% (S)-DTBM-Garphos™
Ref: 08-15-1673
100mg | 168.00 € | ||
500mg | 633.00 € |

(S)-(4,4²,6,6²-Tetramethoxybiphenyl-2,2²-diyl)bis(bis(3,5-di-tert-butyl-4-methoxyphenyl)phosphine
Ref: 3D-QEC53199
1g | Discontinued | Request information | |
5g | Discontinued | Request information |